C18H24 — CID 162270932
2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 162270932) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 162270932 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CC1=CC2CC3C=C(C(C)(C)C)C=CC3C2C=C1 |
| InChI | InChI=1S/C18H24/c1-12-5-7-16-13(9-12)10-14-11-15(18(2,3)4)6-8-17(14)16/h5-9,11,13-14,16-17H,10H2,1-4H3 |
| InChIKey | WWPHXWXGVGHXIH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |