C41H56 — CID 59637812
2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)ethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 59637812) has the molecular formula C41H56 and a molecular weight of 548.90 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)ethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)ethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 59637812 |
| Molecular Formula | C41H56 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)ethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CC1=CC2C(C=C1)C1C=CC(C(C)(C)C)=CC1C2CCC1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C41H56/c1-25-11-15-29-30-16-12-26(39(2,3)4)22-36(30)33(35(29)21-25)19-20-34-37-23-27(40(5,6)7)13-17-31(37)32-18-14-28(24-38(32)34)41(8,9)10/h11-18,21-24,29-38H,19-20H2,1-10H3 |
| InChIKey | DPSKTIQGLXTSKT-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |