C37H46Si — CID 59637786
2,3,3a,7a-tetrahydro-1H-inden-1-yl-but-3-enyl-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-phenylsilane (PubChem CID 59637786) has the molecular formula C37H46Si and a molecular weight of 518.86 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-1-yl-but-3-enyl-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-phenylsilane.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-but-3-enyl-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-phenylsilane |
|---|---|
| PubChem CID | 59637786 |
| Molecular Formula | C37H46Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-but-3-enyl-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-phenylsilane |
| SMILES | C=CCC[Si](c1ccccc1)(C1CCC2C=CC=CC21)C1C2C=C(C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C37H46Si/c1-6-7-23-38(29-14-9-8-10-15-29,35-22-18-27-13-11-12-16-30(27)35)36-33-24-26(2)17-20-31(33)32-21-19-28(25-34(32)36)37(3,4)5/h6,8-17,19-21,24-25,27,30-36H,1,7,18,22-23H2,2-5H3 |
| InChIKey | MXHJDRNDBMXNRT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|