C42H52 — CID 162277050
2-tert-butyl-7-methyl-9-[2-(3-pent-4-enylcyclopentyl)-2,2-diphenylethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 162277050) has the molecular formula C42H52 and a molecular weight of 556.88 g/mol. Its IUPAC name is 2-tert-butyl-7-methyl-9-[2-(3-pent-4-enylcyclopentyl)-2,2-diphenylethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2-tert-butyl-7-methyl-9-[2-(3-pent-4-enylcyclopentyl)-2,2-diphenylethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 162277050 |
| Molecular Formula | C42H52 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | 2-tert-butyl-7-methyl-9-[2-(3-pent-4-enylcyclopentyl)-2,2-diphenylethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCCC1CCC(C(CC2C3C=C(C)C=CC3C3C=CC(C(C)(C)C)=CC32)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C42H52/c1-6-7-10-15-31-21-22-35(27-31)42(32-16-11-8-12-17-32,33-18-13-9-14-19-33)29-40-38-26-30(2)20-24-36(38)37-25-23-34(28-39(37)40)41(3,4)5/h6,8-9,11-14,16-20,23-26,28,31,35-40H,1,7,10,15,21-22,27,29H2,2-5H3 |
| InChIKey | QTSPFSVMKQGCLJ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|