C44H58 — CID 140576056
2,7-ditert-butyl-9-[(3-pentylcyclopentyl)-diphenylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 140576056) has the molecular formula C44H58 and a molecular weight of 586.95 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[(3-pentylcyclopentyl)-diphenylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[(3-pentylcyclopentyl)-diphenylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 140576056 |
| Molecular Formula | C44H58 |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 586.45 |
| IUPAC Name | 2,7-ditert-butyl-9-[(3-pentylcyclopentyl)-diphenylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CCCCCC1CCC(C(c2ccccc2)(c2ccccc2)C2C3C=C(C(C)(C)C)C=CC3C3C=CC(C(C)(C)C)=CC32)C1 |
| InChI | InChI=1S/C44H58/c1-8-9-12-17-31-22-23-36(28-31)44(32-18-13-10-14-19-32,33-20-15-11-16-21-33)41-39-29-34(42(2,3)4)24-26-37(39)38-27-25-35(30-40(38)41)43(5,6)7/h10-11,13-16,18-21,24-27,29-31,36-41H,8-9,12,17,22-23,28H2,1-7H3 |
| InChIKey | JWEKHEZNZSHNCC-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|