C24H31P — CID 102030256
bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-phenylphosphane (PubChem CID 102030256) has the molecular formula C24H31P and a molecular weight of 350.49 g/mol. Its IUPAC name is bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-phenylphosphane.
| Compound Name | bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-phenylphosphane |
|---|---|
| PubChem CID | 102030256 |
| Molecular Formula | C24H31P |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-phenylphosphane |
| SMILES | CC(C)(C)C1=CC(P(c2ccccc2)C2C=CC(C(C)(C)C)=C2)C=C1 |
| InChI | InChI=1S/C24H31P/c1-23(2,3)18-12-14-21(16-18)25(20-10-8-7-9-11-20)22-15-13-19(17-22)24(4,5)6/h7-17,21-22H,1-6H3 |
| InChIKey | NHYMUKWLAXQMRH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|