C17H24Si — CID 141139818
trimethyl-[3-(2-phenylpropan-2-yl)cyclopenta-2,4-dien-1-yl]silane (PubChem CID 141139818) has the molecular formula C17H24Si and a molecular weight of 256.46 g/mol. Its IUPAC name is trimethyl-[3-(2-phenylpropan-2-yl)cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[3-(2-phenylpropan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 141139818 |
| Molecular Formula | C17H24Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | trimethyl-[3-(2-phenylpropan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC(C)(C1=CC([Si](C)(C)C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C17H24Si/c1-17(2,14-9-7-6-8-10-14)15-11-12-16(13-15)18(3,4)5/h6-13,16H,1-5H3 |
| InChIKey | OJYYQJVGFCSAIV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|