C21H23P — CID 15822183
(3-tert-butylcyclopenta-2,4-dien-1-yl)-diphenylphosphane (PubChem CID 15822183) has the molecular formula C21H23P and a molecular weight of 306.39 g/mol. Its IUPAC name is (3-tert-butylcyclopenta-2,4-dien-1-yl)-diphenylphosphane.
| Compound Name | (3-tert-butylcyclopenta-2,4-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 15822183 |
| Molecular Formula | C21H23P |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3-tert-butylcyclopenta-2,4-dien-1-yl)-diphenylphosphane |
| SMILES | CC(C)(C)C1=CC(P(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C21H23P/c1-21(2,3)17-14-15-20(16-17)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-16,20H,1-3H3 |
| InChIKey | ZRURBCMVNADDDH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|