C19H19P — CID 123887097
(6-methylcyclohexa-2,4-dien-1-yl)-diphenylphosphane (PubChem CID 123887097) has the molecular formula C19H19P and a molecular weight of 278.34 g/mol. Its IUPAC name is (6-methylcyclohexa-2,4-dien-1-yl)-diphenylphosphane.
| Compound Name | (6-methylcyclohexa-2,4-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 123887097 |
| Molecular Formula | C19H19P |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (6-methylcyclohexa-2,4-dien-1-yl)-diphenylphosphane |
| SMILES | CC1C=CC=CC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19P/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-16,19H,1H3 |
| InChIKey | FFEJTVYQPKSECY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|