C20H19+ — CID 123994416
[(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]benzene (PubChem CID 123994416) has the molecular formula C20H19+ and a molecular weight of 259.37 g/mol. Its IUPAC name is [(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]benzene.
| Compound Name | [(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]benzene |
|---|---|
| PubChem CID | 123994416 |
| Molecular Formula | C20H19+ |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]benzene |
| SMILES | CC1C=CC=CC1[C+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-16,19H,1H3/q+1 |
| InChIKey | YJKWBSFBWDRYGC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|