C16H16O — CID 150975745
3-(6-methylcyclohexa-2,4-dien-1-yl)-1-phenylprop-2-en-1-one (PubChem CID 150975745) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(6-methylcyclohexa-2,4-dien-1-yl)-1-phenylprop-2-en-1-one.
| Compound Name | 3-(6-methylcyclohexa-2,4-dien-1-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 150975745 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(6-methylcyclohexa-2,4-dien-1-yl)-1-phenylprop-2-en-1-one |
| SMILES | CC1C=CC=CC1C=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O/c1-13-7-5-6-8-14(13)11-12-16(17)15-9-3-2-4-10-15/h2-14H,1H3 |
| InChIKey | LPBGJZKHSVTYGR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|