acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one

C17H18O3 — CID 175178095

IUPACacetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one
SMILESCC(=O)O.O=C(C=CC1C=CC=CC1)c1ccccc1
InChIInChI=1S/C15H14O.C2H4O2/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2(3)4/h1-7,9-13H,8H2;1H3,(H,3,4)
InChIKeyUHXJAKCRARICSP-UHFFFAOYSA-N
MW270.33 g/mol
LogP3.65
Rot. Bonds3

About acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one

acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one (PubChem CID 175178095) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one.

Molecular Properties

Compound Nameacetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one
PubChem CID175178095
Molecular FormulaC17H18O3
Molecular Weight270.33 g/mol
Exact Mass270.13
IUPAC Nameacetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one
SMILESCC(=O)O.O=C(C=CC1C=CC=CC1)c1ccccc1
InChIInChI=1S/C15H14O.C2H4O2/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2(3)4/h1-7,9-13H,8H2;1H3,(H,3,4)
InChIKeyUHXJAKCRARICSP-UHFFFAOYSA-N
XLogP3.65
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.33
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one?
The IUPAC name of acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one (CID 175178095) is acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one.
What is the SMILES notation for acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one?
The canonical SMILES for acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one is CC(=O)O.O=C(C=CC1C=CC=CC1)c1ccccc1.
What is the InChIKey of acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one?
The InChIKey is UHXJAKCRARICSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C2H4O2/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2(3)4/h1-7,9-13H,8H2;1H3,(H,3,4).
What are the key properties of acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one?
acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one has a molecular weight of 270.33 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one is sourced from PubChem (CID 175178095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).