C17H18O3 — CID 175178095
acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one (PubChem CID 175178095) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one.
| Compound Name | acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 175178095 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | acetic acid;3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one |
| SMILES | CC(=O)O.O=C(C=CC1C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C15H14O.C2H4O2/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2(3)4/h1-7,9-13H,8H2;1H3,(H,3,4) |
| InChIKey | UHXJAKCRARICSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|