C17H18O — CID 151227666
3-cyclohexa-2,4-dien-1-yl-2-methyl-1-phenylbut-2-en-1-one (PubChem CID 151227666) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-2-methyl-1-phenylbut-2-en-1-one.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-2-methyl-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 151227666 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-2-methyl-1-phenylbut-2-en-1-one |
| SMILES | CC(C(=O)c1ccccc1)=C(C)C1C=CC=CC1 |
| InChI | InChI=1S/C17H18O/c1-13(15-9-5-3-6-10-15)14(2)17(18)16-11-7-4-8-12-16/h3-9,11-12,15H,10H2,1-2H3 |
| InChIKey | NNPLJGROJDIWPR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|