C11H12O2 — CID 11001591
(Z)-1-cyclohexa-2,4-dien-1-ylpent-2-ene-1,4-dione (PubChem CID 11001591) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (Z)-1-cyclohexa-2,4-dien-1-ylpent-2-ene-1,4-dione.
| Compound Name | (Z)-1-cyclohexa-2,4-dien-1-ylpent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 11001591 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (Z)-1-cyclohexa-2,4-dien-1-ylpent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C\C(=O)C1C=CC=CC1 |
| InChI | InChI=1S/C11H12O2/c1-9(12)7-8-11(13)10-5-3-2-4-6-10/h2-5,7-8,10H,6H2,1H3/b8-7- |
| InChIKey | CANJWQGBPAJEKE-FPLPWBNLSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|