C15H16N2O — CID 154433755
2,3-diamino-3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one (PubChem CID 154433755) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 2,3-diamino-3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one.
| Compound Name | 2,3-diamino-3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 154433755 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2,3-diamino-3-cyclohexa-2,4-dien-1-yl-1-phenylprop-2-en-1-one |
| SMILES | NC(C(=O)c1ccccc1)=C(N)C1C=CC=CC1 |
| InChI | InChI=1S/C15H16N2O/c16-13(11-7-3-1-4-8-11)14(17)15(18)12-9-5-2-6-10-12/h1-7,9-11H,8,16-17H2 |
| InChIKey | SGTRMQYZHWWVRY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|