C13H15N3 — CID 145141078
N-amino-N-cyclohexa-2,4-dien-1-ylbenzenecarboximidamide (PubChem CID 145141078) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-amino-N-cyclohexa-2,4-dien-1-ylbenzenecarboximidamide.
| Compound Name | N-amino-N-cyclohexa-2,4-dien-1-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145141078 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-amino-N-cyclohexa-2,4-dien-1-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1ccccc1)N(N)C1C=CC=CC1 |
| InChI | InChI=1S/C13H15N3/c14-13(11-7-3-1-4-8-11)16(15)12-9-5-2-6-10-12/h1-9,12,14H,10,15H2/b14-13+ |
| InChIKey | CRRZFVWNFVHKMI-BUHFOSPRSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|