C18H17NO2S — CID 143420402
N-cyclohexa-2,4-dien-1-yl-N-phenylbenzenesulfonamide (PubChem CID 143420402) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-phenylbenzenesulfonamide.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 143420402 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C18H17NO2S/c20-22(21,18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-12,14-15,17H,13H2 |
| InChIKey | BCCMJQQIPRCJGI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |