C30H39NO2 — CID 91209194
[4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 91209194) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is [4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 91209194 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | [4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)Oc1ccc(N(c2ccccc2)C2C=CC=CC2)cc1)C(C)(C)C |
| InChI | InChI=1S/C30H39NO2/c1-28(2,3)22-30(7,29(4,5)6)27(32)33-26-20-18-25(19-21-26)31(23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-16,18-21,24H,17,22H2,1-7H3 |
| InChIKey | CJBXWNWBCLRIEY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|