C39H35IN2 — CID 143129602
N-cyclohexa-2,4-dien-1-yl-N-[4-[4-[2-(N-(3-iodophenyl)anilino)ethyl]phenyl]phenyl]-3-methylaniline (PubChem CID 143129602) has the molecular formula C39H35IN2 and a molecular weight of 658.63 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-[4-[4-[2-(N-(3-iodophenyl)anilino)ethyl]phenyl]phenyl]-3-methylaniline.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-[4-[4-[2-(N-(3-iodophenyl)anilino)ethyl]phenyl]phenyl]-3-methylaniline |
|---|---|
| PubChem CID | 143129602 |
| Molecular Formula | C39H35IN2 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-[4-[4-[2-(N-(3-iodophenyl)anilino)ethyl]phenyl]phenyl]-3-methylaniline |
| SMILES | Cc1cccc(N(c2ccc(-c3ccc(CCN(c4ccccc4)c4cccc(I)c4)cc3)cc2)C2C=CC=CC2)c1 |
| InChI | InChI=1S/C39H35IN2/c1-30-10-8-17-39(28-30)42(36-14-6-3-7-15-36)37-24-22-33(23-25-37)32-20-18-31(19-21-32)26-27-41(35-12-4-2-5-13-35)38-16-9-11-34(40)29-38/h2-14,16-25,28-29,36H,15,26-27H2,1H3 |
| InChIKey | KKAMTTDIUPKWCD-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|