C38H38N2 — CID 167281793
N-[4-[4-[cyclohexa-2,4-dien-1-yl-(3-methylcyclohex-2-en-1-yl)amino]phenyl]phenyl]-3-methyl-N-phenylaniline (PubChem CID 167281793) has the molecular formula C38H38N2 and a molecular weight of 522.74 g/mol. Its IUPAC name is N-[4-[4-[cyclohexa-2,4-dien-1-yl-(3-methylcyclohex-2-en-1-yl)amino]phenyl]phenyl]-3-methyl-N-phenylaniline.
| Compound Name | N-[4-[4-[cyclohexa-2,4-dien-1-yl-(3-methylcyclohex-2-en-1-yl)amino]phenyl]phenyl]-3-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 167281793 |
| Molecular Formula | C38H38N2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | N-[4-[4-[cyclohexa-2,4-dien-1-yl-(3-methylcyclohex-2-en-1-yl)amino]phenyl]phenyl]-3-methyl-N-phenylaniline |
| SMILES | CC1=CC(N(c2ccc(-c3ccc(N(c4ccccc4)c4cccc(C)c4)cc3)cc2)C2C=CC=CC2)CCC1 |
| InChI | InChI=1S/C38H38N2/c1-29-11-9-17-37(27-29)39(33-13-5-3-6-14-33)35-23-19-31(20-24-35)32-21-25-36(26-22-32)40(34-15-7-4-8-16-34)38-18-10-12-30(2)28-38/h3-9,11,13-15,17,19-28,34,38H,10,12,16,18H2,1-2H3 |
| InChIKey | FPQZXDUUBBYGGC-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|