C13H13NO — CID 154350232
4-cyclohexa-2,4-dien-1-ylbenzamide (PubChem CID 154350232) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-ylbenzamide.
| Compound Name | 4-cyclohexa-2,4-dien-1-ylbenzamide |
|---|---|
| PubChem CID | 154350232 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C13H13NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-4,6-10H,5H2,(H2,14,15) |
| InChIKey | YGOISLSRCXWMAT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |