C12H11Cl — CID 13139025
1-chloro-4-cyclohexa-2,4-dien-1-ylbenzene (PubChem CID 13139025) has the molecular formula C12H11Cl and a molecular weight of 190.67 g/mol. Its IUPAC name is 1-chloro-4-cyclohexa-2,4-dien-1-ylbenzene.
| Compound Name | 1-chloro-4-cyclohexa-2,4-dien-1-ylbenzene |
|---|---|
| PubChem CID | 13139025 |
| Molecular Formula | C12H11Cl |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-chloro-4-cyclohexa-2,4-dien-1-ylbenzene |
| SMILES | Clc1ccc(C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C12H11Cl/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-4,6-10H,5H2 |
| InChIKey | VOQGMVQMSMVNAZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |