C10H9ClN2 — CID 123707586
2-chloro-5-cyclohexa-2,4-dien-1-ylpyrimidine (PubChem CID 123707586) has the molecular formula C10H9ClN2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 2-chloro-5-cyclohexa-2,4-dien-1-ylpyrimidine.
| Compound Name | 2-chloro-5-cyclohexa-2,4-dien-1-ylpyrimidine |
|---|---|
| PubChem CID | 123707586 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-chloro-5-cyclohexa-2,4-dien-1-ylpyrimidine |
| SMILES | Clc1ncc(C2C=CC=CC2)cn1 |
| InChI | InChI=1S/C10H9ClN2/c11-10-12-6-9(7-13-10)8-4-2-1-3-5-8/h1-4,6-8H,5H2 |
| InChIKey | CVGLTCZBQAHIEM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |