C15H19N — CID 145073957
2-(4-cyclohexa-2,4-dien-1-ylphenyl)propan-2-amine (PubChem CID 145073957) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(4-cyclohexa-2,4-dien-1-ylphenyl)propan-2-amine.
| Compound Name | 2-(4-cyclohexa-2,4-dien-1-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 145073957 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(4-cyclohexa-2,4-dien-1-ylphenyl)propan-2-amine |
| SMILES | CC(C)(N)c1ccc(C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C15H19N/c1-15(2,16)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-6,8-12H,7,16H2,1-2H3 |
| InChIKey | DREZRPVMMKGVQA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |