C7H5ClN2O2 — CID 141389024
2-chloro-5-(1,3-dioxol-2-yl)pyrimidine (PubChem CID 141389024) has the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. Its IUPAC name is 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine.
| Compound Name | 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine |
|---|---|
| PubChem CID | 141389024 |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine |
| SMILES | Clc1ncc(C2OC=CO2)cn1 |
| InChI | InChI=1S/C7H5ClN2O2/c8-7-9-3-5(4-10-7)6-11-1-2-12-6/h1-4,6H |
| InChIKey | WVRBSWRDAIFADB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |