About 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine
2-chloro-5-(1,3-dioxol-2-yl)pyrimidine (PubChem CID 141389024) has the molecular formula C7H5ClN2O2
and a molecular weight of 184.58 g/mol. Its IUPAC name is 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine |
| PubChem CID | 141389024 |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine |
| SMILES | Clc1ncc(C2OC=CO2)cn1 |
| InChI | InChI=1S/C7H5ClN2O2/c8-7-9-3-5(4-10-7)6-11-1-2-12-6/h1-4,6H |
| InChIKey | WVRBSWRDAIFADB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine?
The IUPAC name of 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine (CID 141389024) is 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine.
What is the SMILES notation for 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine?
The canonical SMILES for 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine is Clc1ncc(C2OC=CO2)cn1.
What is the InChIKey of 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine?
The InChIKey is WVRBSWRDAIFADB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O2/c8-7-9-3-5(4-10-7)6-11-1-2-12-6/h1-4,6H.
What are the key properties of 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine?
2-chloro-5-(1,3-dioxol-2-yl)pyrimidine has a molecular weight of 184.58 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(1,3-dioxol-2-yl)pyrimidine is sourced from PubChem (CID 141389024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).