C15H12OSe — CID 175705929
(E)-1-phenyl-3-(6-selanylidenecyclohexa-2,4-dien-1-yl)prop-2-en-1-one (PubChem CID 175705929) has the molecular formula C15H12OSe and a molecular weight of 287.22 g/mol. Its IUPAC name is (E)-1-phenyl-3-(6-selanylidenecyclohexa-2,4-dien-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-phenyl-3-(6-selanylidenecyclohexa-2,4-dien-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175705929 |
| Molecular Formula | C15H12OSe |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (E)-1-phenyl-3-(6-selanylidenecyclohexa-2,4-dien-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/C1C=CC=CC1=[Se])c1ccccc1 |
| InChI | InChI=1S/C15H12OSe/c16-14(12-6-2-1-3-7-12)11-10-13-8-4-5-9-15(13)17/h1-11,13H/b11-10+ |
| InChIKey | VIFQAZWMJHAMLU-ZHACJKMWSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|