C19H24N2O — CID 22239260
(E)-3-[4,4-bis(dimethylamino)cyclohexa-2,5-dien-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 22239260) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (E)-3-[4,4-bis(dimethylamino)cyclohexa-2,5-dien-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[4,4-bis(dimethylamino)cyclohexa-2,5-dien-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 22239260 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (E)-3-[4,4-bis(dimethylamino)cyclohexa-2,5-dien-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | CN(C)C1(N(C)C)C=CC(/C=C/C(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C19H24N2O/c1-20(2)19(21(3)4)14-12-16(13-15-19)10-11-18(22)17-8-6-5-7-9-17/h5-16H,1-4H3/b11-10+ |
| InChIKey | LDLCBIXWPJSWQO-ZHACJKMWSA-N |
| XLogP | 2.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|