C21H19NO6S — CID 68828398
N-[1,2-dihydroxy-4-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,5-dien-1-yl]-3-hydroxybenzenesulfonamide (PubChem CID 68828398) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[1,2-dihydroxy-4-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,5-dien-1-yl]-3-hydroxybenzenesulfonamide.
| Compound Name | N-[1,2-dihydroxy-4-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,5-dien-1-yl]-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 68828398 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[1,2-dihydroxy-4-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,5-dien-1-yl]-3-hydroxybenzenesulfonamide |
| SMILES | O=C(/C=C/C1C=CC(O)(NS(=O)(=O)c2cccc(O)c2)C(O)=C1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO6S/c23-17-7-4-8-18(14-17)29(27,28)22-21(26)12-11-15(13-20(21)25)9-10-19(24)16-5-2-1-3-6-16/h1-15,22-23,25-26H/b10-9+ |
| InChIKey | CQDQRAQYXQHSCT-MDZDMXLPSA-N |
| XLogP | 2.43 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|