C21H19NO5S — CID 68828813
3-hydroxy-N-[1-hydroxy-5-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,4-dien-1-yl]benzenesulfonamide (PubChem CID 68828813) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-hydroxy-N-[1-hydroxy-5-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,4-dien-1-yl]benzenesulfonamide.
| Compound Name | 3-hydroxy-N-[1-hydroxy-5-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,4-dien-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 68828813 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-hydroxy-N-[1-hydroxy-5-[(E)-3-oxo-3-phenylprop-1-enyl]cyclohexa-2,4-dien-1-yl]benzenesulfonamide |
| SMILES | O=C(/C=C/C1=CC=CC(O)(NS(=O)(=O)c2cccc(O)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO5S/c23-18-9-4-10-19(14-18)28(26,27)22-21(25)13-5-6-16(15-21)11-12-20(24)17-7-2-1-3-8-17/h1-14,22-23,25H,15H2/b12-11+ |
| InChIKey | IYTGTZNHKONFJL-VAWYXSNFSA-N |
| XLogP | 2.68 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|