C18H22S2 — CID 123189116
2-phenylpropan-2-yl 2-(6-methylcyclohexa-2,4-dien-1-yl)ethanedithioate (PubChem CID 123189116) has the molecular formula C18H22S2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-(6-methylcyclohexa-2,4-dien-1-yl)ethanedithioate.
| Compound Name | 2-phenylpropan-2-yl 2-(6-methylcyclohexa-2,4-dien-1-yl)ethanedithioate |
|---|---|
| PubChem CID | 123189116 |
| Molecular Formula | C18H22S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-phenylpropan-2-yl 2-(6-methylcyclohexa-2,4-dien-1-yl)ethanedithioate |
| SMILES | CC1C=CC=CC1CC(=S)SC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H22S2/c1-14-9-7-8-10-15(14)13-17(19)20-18(2,3)16-11-5-4-6-12-16/h4-12,14-15H,13H2,1-3H3 |
| InChIKey | SADMBBWSEUGFHA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|