C17H13Cl2P — CID 87145521
(2,3-dichlorocyclopenta-2,4-dien-1-yl)-diphenylphosphane (PubChem CID 87145521) has the molecular formula C17H13Cl2P and a molecular weight of 319.17 g/mol. Its IUPAC name is (2,3-dichlorocyclopenta-2,4-dien-1-yl)-diphenylphosphane.
| Compound Name | (2,3-dichlorocyclopenta-2,4-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 87145521 |
| Molecular Formula | C17H13Cl2P |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2,3-dichlorocyclopenta-2,4-dien-1-yl)-diphenylphosphane |
| SMILES | ClC1=C(Cl)C(P(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C17H13Cl2P/c18-15-11-12-16(17(15)19)20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,16H |
| InChIKey | QSBXJVDSBMGDDQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|