C23H22ClOP — CID 70568716
5-chloro-1-(6-diphenylphosphanylcyclohexa-2,4-dien-1-ylidene)pentan-2-one (PubChem CID 70568716) has the molecular formula C23H22ClOP and a molecular weight of 380.86 g/mol. Its IUPAC name is 5-chloro-1-(6-diphenylphosphanylcyclohexa-2,4-dien-1-ylidene)pentan-2-one.
| Compound Name | 5-chloro-1-(6-diphenylphosphanylcyclohexa-2,4-dien-1-ylidene)pentan-2-one |
|---|---|
| PubChem CID | 70568716 |
| Molecular Formula | C23H22ClOP |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-chloro-1-(6-diphenylphosphanylcyclohexa-2,4-dien-1-ylidene)pentan-2-one |
| SMILES | O=C(C=C1C=CC=CC1P(c1ccccc1)c1ccccc1)CCCCl |
| InChI | InChI=1S/C23H22ClOP/c24-17-9-11-20(25)18-19-10-7-8-16-23(19)26(21-12-3-1-4-13-21)22-14-5-2-6-15-22/h1-8,10,12-16,18,23H,9,11,17H2 |
| InChIKey | NZMGYNGUOUMLRL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|