C19H17P — CID 102163654
(2-ethenylcyclopenta-2,4-dien-1-yl)-diphenylphosphane (PubChem CID 102163654) has the molecular formula C19H17P and a molecular weight of 276.32 g/mol. Its IUPAC name is (2-ethenylcyclopenta-2,4-dien-1-yl)-diphenylphosphane.
| Compound Name | (2-ethenylcyclopenta-2,4-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 102163654 |
| Molecular Formula | C19H17P |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2-ethenylcyclopenta-2,4-dien-1-yl)-diphenylphosphane |
| SMILES | C=CC1=CC=CC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17P/c1-2-16-10-9-15-19(16)20(17-11-5-3-6-12-17)18-13-7-4-8-14-18/h2-15,19H,1H2 |
| InChIKey | JMBIFAJCPTXZIE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|