C17H16 — CID 174289399
5-benzylidene-1,6-bis(ethenyl)cyclohexa-1,3-diene (PubChem CID 174289399) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 5-benzylidene-1,6-bis(ethenyl)cyclohexa-1,3-diene.
| Compound Name | 5-benzylidene-1,6-bis(ethenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174289399 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-benzylidene-1,6-bis(ethenyl)cyclohexa-1,3-diene |
| SMILES | C=CC1=CC=CC(=Cc2ccccc2)C1C=C |
| InChI | InChI=1S/C17H16/c1-3-15-11-8-12-16(17(15)4-2)13-14-9-6-5-7-10-14/h3-13,17H,1-2H2 |
| InChIKey | FALIFPJMESEVSM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|