C21H23O2P — CID 122497284
2-[1-[(5S)-5-diphenylphosphanylcyclopenta-1,3-dien-1-yl]ethoxy]ethanol (PubChem CID 122497284) has the molecular formula C21H23O2P and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-[1-[(5S)-5-diphenylphosphanylcyclopenta-1,3-dien-1-yl]ethoxy]ethanol.
| Compound Name | 2-[1-[(5S)-5-diphenylphosphanylcyclopenta-1,3-dien-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 122497284 |
| Molecular Formula | C21H23O2P |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[1-[(5S)-5-diphenylphosphanylcyclopenta-1,3-dien-1-yl]ethoxy]ethanol |
| SMILES | CC(OCCO)C1=CC=C[C@@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23O2P/c1-17(23-16-15-22)20-13-8-14-21(20)24(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-14,17,21-22H,15-16H2,1H3/t17?,21-/m0/s1 |
| InChIKey | ACSFDKFJUSEEQJ-LFABVHOISA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|