About cumene;2-(2-fluoroethoxy)ethanol
cumene;2-(2-fluoroethoxy)ethanol (PubChem CID 142309026) has the molecular formula C13H21FO2
and a molecular weight of 228.31 g/mol. Its IUPAC name is cumene;2-(2-fluoroethoxy)ethanol.
Molecular Properties
| Compound Name | cumene;2-(2-fluoroethoxy)ethanol |
| PubChem CID | 142309026 |
| Molecular Formula | C13H21FO2 |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cumene;2-(2-fluoroethoxy)ethanol |
| SMILES | CC(C)c1ccccc1.OCCOCCF |
| InChI | InChI=1S/C9H12.C4H9FO2/c1-8(2)9-6-4-3-5-7-9;5-1-3-7-4-2-6/h3-8H,1-2H3;6H,1-4H2 |
| InChIKey | PIFXXZNYNSTGRA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cumene;2-(2-fluoroethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;2-(2-fluoroethoxy)ethanol?
The IUPAC name of cumene;2-(2-fluoroethoxy)ethanol (CID 142309026) is cumene;2-(2-fluoroethoxy)ethanol.
What is the SMILES notation for cumene;2-(2-fluoroethoxy)ethanol?
The canonical SMILES for cumene;2-(2-fluoroethoxy)ethanol is CC(C)c1ccccc1.OCCOCCF.
What is the InChIKey of cumene;2-(2-fluoroethoxy)ethanol?
The InChIKey is PIFXXZNYNSTGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C4H9FO2/c1-8(2)9-6-4-3-5-7-9;5-1-3-7-4-2-6/h3-8H,1-2H3;6H,1-4H2.
What are the key properties of cumene;2-(2-fluoroethoxy)ethanol?
cumene;2-(2-fluoroethoxy)ethanol has a molecular weight of 228.31 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;2-(2-fluoroethoxy)ethanol is sourced from PubChem (CID 142309026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).