C19H14F3OP — CID 150762300
6-[phenyl-[4-(trifluoromethyl)phenyl]phosphanyl]cyclohexa-2,4-dien-1-one (PubChem CID 150762300) has the molecular formula C19H14F3OP and a molecular weight of 346.29 g/mol. Its IUPAC name is 6-[phenyl-[4-(trifluoromethyl)phenyl]phosphanyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 6-[phenyl-[4-(trifluoromethyl)phenyl]phosphanyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 150762300 |
| Molecular Formula | C19H14F3OP |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 6-[phenyl-[4-(trifluoromethyl)phenyl]phosphanyl]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1P(c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3OP/c20-19(21,22)14-10-12-16(13-11-14)24(15-6-2-1-3-7-15)18-9-5-4-8-17(18)23/h1-13,18H |
| InChIKey | JYBZNSQTNTZGJJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|