C27H21F6P — CID 102469659
[(1S,4R,7S)-2-phenyl-7-bicyclo[2.2.1]hept-2-enyl]-bis[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 102469659) has the molecular formula C27H21F6P and a molecular weight of 490.43 g/mol. Its IUPAC name is [(1S,4R,7S)-2-phenyl-7-bicyclo[2.2.1]hept-2-enyl]-bis[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [(1S,4R,7S)-2-phenyl-7-bicyclo[2.2.1]hept-2-enyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 102469659 |
| Molecular Formula | C27H21F6P |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [(1S,4R,7S)-2-phenyl-7-bicyclo[2.2.1]hept-2-enyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | FC(F)(F)c1ccc(P(c2ccc(C(F)(F)F)cc2)[C@H]2[C@H]3C=C(c4ccccc4)[C@@H]2CC3)cc1 |
| InChI | InChI=1S/C27H21F6P/c28-26(29,30)19-7-11-21(12-8-19)34(22-13-9-20(10-14-22)27(31,32)33)25-18-6-15-23(25)24(16-18)17-4-2-1-3-5-17/h1-5,7-14,16,18,23,25H,6,15H2/t18-,23+,25+/m1/s1 |
| InChIKey | MZXPUMPTVBVZGC-DPQOWFAMSA-N |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|