C18H18F3N — CID 14181100
(3R,4R)-3-phenyl-4-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 14181100) has the molecular formula C18H18F3N and a molecular weight of 305.34 g/mol. Its IUPAC name is (3R,4R)-3-phenyl-4-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | (3R,4R)-3-phenyl-4-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 14181100 |
| Molecular Formula | C18H18F3N |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3R,4R)-3-phenyl-4-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | FC(F)(F)c1ccc([C@@H]2CCNC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18F3N/c19-18(20,21)15-8-6-14(7-9-15)16-10-11-22-12-17(16)13-4-2-1-3-5-13/h1-9,16-17,22H,10-12H2/t16-,17-/m0/s1 |
| InChIKey | IPHFBOOEJZKNNZ-IRXDYDNUSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |