C10H14Cl2 — CID 131844494
(4R,6R)-4-chloro-6-(2-chloropropan-2-yl)-3-methylidenecyclohexene (PubChem CID 131844494) has the molecular formula C10H14Cl2 and a molecular weight of 205.13 g/mol. Its IUPAC name is (4R,6R)-4-chloro-6-(2-chloropropan-2-yl)-3-methylidenecyclohexene.
| Compound Name | (4R,6R)-4-chloro-6-(2-chloropropan-2-yl)-3-methylidenecyclohexene |
|---|---|
| PubChem CID | 131844494 |
| Molecular Formula | C10H14Cl2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (4R,6R)-4-chloro-6-(2-chloropropan-2-yl)-3-methylidenecyclohexene |
| SMILES | C=C1C=C[C@H](C(C)(C)Cl)C[C@H]1Cl |
| InChI | InChI=1S/C10H14Cl2/c1-7-4-5-8(6-9(7)11)10(2,3)12/h4-5,8-9H,1,6H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | ASIQASHPLUVGAM-DTWKUNHWSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|