C9H10 — CID 134964182
(4R)-5,6-dimethylidenebicyclo[2.2.1]hept-2-ene (PubChem CID 134964182) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is (4R)-5,6-dimethylidenebicyclo[2.2.1]hept-2-ene.
| Compound Name | (4R)-5,6-dimethylidenebicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 134964182 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | (4R)-5,6-dimethylidenebicyclo[2.2.1]hept-2-ene |
| SMILES | C=C1C(=C)[C@H]2C=CC1C2 |
| InChI | InChI=1S/C9H10/c1-6-7(2)9-4-3-8(6)5-9/h3-4,8-9H,1-2,5H2/t8-,9?/m0/s1 |
| InChIKey | LEHFKOPSVFOJDF-IENPIDJESA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|