C11H14 — CID 121219171
10-methylidenetricyclo[4.3.1.03,8]dec-4-ene (PubChem CID 121219171) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 10-methylidenetricyclo[4.3.1.03,8]dec-4-ene.
| Compound Name | 10-methylidenetricyclo[4.3.1.03,8]dec-4-ene |
|---|---|
| PubChem CID | 121219171 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 10-methylidenetricyclo[4.3.1.03,8]dec-4-ene |
| SMILES | C=C1C2C=CC3CC1CC3C2 |
| InChI | InChI=1S/C11H14/c1-7-8-2-3-9-5-10(7)6-11(9)4-8/h2-3,8-11H,1,4-6H2 |
| InChIKey | MAYVXOAHQIVBKR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|