C13H14 — CID 101270230
(1R,3S,6R,8S)-tetracyclo[6.2.2.13,6.02,7]trideca-2(7),4,9-triene (PubChem CID 101270230) has the molecular formula C13H14 and a molecular weight of 170.26 g/mol. Its IUPAC name is (1R,3S,6R,8S)-tetracyclo[6.2.2.13,6.02,7]trideca-2(7),4,9-triene.
| Compound Name | (1R,3S,6R,8S)-tetracyclo[6.2.2.13,6.02,7]trideca-2(7),4,9-triene |
|---|---|
| PubChem CID | 101270230 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1R,3S,6R,8S)-tetracyclo[6.2.2.13,6.02,7]trideca-2(7),4,9-triene |
| SMILES | C1=C[C@H]2C[C@@H]1C1=C2[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C13H14/c1-2-9-4-3-8(1)12-10-5-6-11(7-10)13(9)12/h1-2,5-6,8-11H,3-4,7H2/t8-,9+,10+,11- |
| InChIKey | KXFRTFWZPDFRIR-CKIJPRSSSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|