C14H16 — CID 158207715
(9E)-9-ethylidenetetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene (PubChem CID 158207715) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is (9E)-9-ethylidenetetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene.
| Compound Name | (9E)-9-ethylidenetetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
|---|---|
| PubChem CID | 158207715 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (9E)-9-ethylidenetetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
| SMILES | C/C=C1\CC2CC1C1=C2C2C=CC1C2 |
| InChI | InChI=1S/C14H16/c1-2-8-5-11-7-12(8)14-10-4-3-9(6-10)13(11)14/h2-4,9-12H,5-7H2,1H3/b8-2+ |
| InChIKey | KKKYRHWXXJONGH-KRXBUXKQSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|