C13H12O2 — CID 123380347
4-methyl-5-methylidenetricyclo[6.2.1.02,7]undeca-2(7),9-diene-3,6-dione (PubChem CID 123380347) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-methyl-5-methylidenetricyclo[6.2.1.02,7]undeca-2(7),9-diene-3,6-dione.
| Compound Name | 4-methyl-5-methylidenetricyclo[6.2.1.02,7]undeca-2(7),9-diene-3,6-dione |
|---|---|
| PubChem CID | 123380347 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4-methyl-5-methylidenetricyclo[6.2.1.02,7]undeca-2(7),9-diene-3,6-dione |
| SMILES | C=C1C(=O)C2=C(C(=O)C1C)C1C=CC2C1 |
| InChI | InChI=1S/C13H12O2/c1-6-7(2)13(15)11-9-4-3-8(5-9)10(11)12(6)14/h3-4,7-9H,1,5H2,2H3 |
| InChIKey | HUSAIKDESBMMBH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|