C20H16O2 — CID 10379358
(1S,4R,7S,10R,11S,14R,15S,18R)-heptacyclo[8.4.4.14,7.111,14.01,10.03,8.015,18]icosa-3(8),5,12,16-tetraene-2,9-dione (PubChem CID 10379358) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1S,4R,7S,10R,11S,14R,15S,18R)-heptacyclo[8.4.4.14,7.111,14.01,10.03,8.015,18]icosa-3(8),5,12,16-tetraene-2,9-dione.
| Compound Name | (1S,4R,7S,10R,11S,14R,15S,18R)-heptacyclo[8.4.4.14,7.111,14.01,10.03,8.015,18]icosa-3(8),5,12,16-tetraene-2,9-dione |
|---|---|
| PubChem CID | 10379358 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (1S,4R,7S,10R,11S,14R,15S,18R)-heptacyclo[8.4.4.14,7.111,14.01,10.03,8.015,18]icosa-3(8),5,12,16-tetraene-2,9-dione |
| SMILES | O=C1C2=C(C(=O)[C@]34[C@H]5C=C[C@H](C5)[C@]13[C@@H]1C=C[C@@H]14)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C20H16O2/c21-17-15-9-1-2-10(7-9)16(15)18(22)20-12-4-3-11(8-12)19(17,20)13-5-6-14(13)20/h1-6,9-14H,7-8H2/t9-,10+,11-,12+,13-,14+,19+,20- |
| InChIKey | VLTTZAJFNUCOJI-YBKMULGOSA-N |
| XLogP | 2.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|