C18H16O2 — CID 101237452
(1S,2S,3S,4R,5R,7S,8R,9S,11R,12R,13R,15S)-octacyclo[10.3.2.12,8.02,11.03,7.04,11.05,9.013,15]octadec-16-ene-10,18-dione (PubChem CID 101237452) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R,7S,8R,9S,11R,12R,13R,15S)-octacyclo[10.3.2.12,8.02,11.03,7.04,11.05,9.013,15]octadec-16-ene-10,18-dione.
| Compound Name | (1S,2S,3S,4R,5R,7S,8R,9S,11R,12R,13R,15S)-octacyclo[10.3.2.12,8.02,11.03,7.04,11.05,9.013,15]octadec-16-ene-10,18-dione |
|---|---|
| PubChem CID | 101237452 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1S,2S,3S,4R,5R,7S,8R,9S,11R,12R,13R,15S)-octacyclo[10.3.2.12,8.02,11.03,7.04,11.05,9.013,15]octadec-16-ene-10,18-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]4[C@@H]2C(=O)[C@]25[C@H]4[C@H]3[C@]12[C@H]1C=C[C@@H]5[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C18H16O2/c19-15-11-7-4-8-12(11)16(20)18-10-2-1-9(5-3-6(5)10)17(15,18)13(7)14(8)18/h1-2,5-14H,3-4H2/t5-,6+,7+,8-,9-,10+,11+,12-,13-,14+,17+,18- |
| InChIKey | JCWJFHYVAOWQQZ-YJIUYNOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|