C16H12O2 — CID 98556936
(1S,3R,4S,6S,7R,8S,9S,10R,13S,16R)-octacyclo[8.6.0.01,6.03,9.04,8.06,13.07,11.012,16]hexadec-14-ene-2,5-dione (PubChem CID 98556936) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1S,3R,4S,6S,7R,8S,9S,10R,13S,16R)-octacyclo[8.6.0.01,6.03,9.04,8.06,13.07,11.012,16]hexadec-14-ene-2,5-dione.
| Compound Name | (1S,3R,4S,6S,7R,8S,9S,10R,13S,16R)-octacyclo[8.6.0.01,6.03,9.04,8.06,13.07,11.012,16]hexadec-14-ene-2,5-dione |
|---|---|
| PubChem CID | 98556936 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (1S,3R,4S,6S,7R,8S,9S,10R,13S,16R)-octacyclo[8.6.0.01,6.03,9.04,8.06,13.07,11.012,16]hexadec-14-ene-2,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3C(=O)[C@@]45[C@@H]6C=C[C@H]7C6C6[C@H]([C@@H]2[C@H]3[C@@H]64)[C@@]175 |
| InChI | InChI=1S/C16H12O2/c17-13-8-6-7-9(8)14(18)16-4-2-1-3-5(4)10(12(7)16)11(6)15(3,13)16/h1-12H/t3-,4+,5?,6-,7-,8-,9+,10?,11+,12+,15-,16-/m1/s1 |
| InChIKey | BLOZHHHWCOYUBC-HRTDFSLZSA-N |
| XLogP | 0.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|