C16H14O — CID 98556963
(6R,9S,10R,11R,12S,15R)-4-methylhexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-3,7,13-trien-2-one (PubChem CID 98556963) has the molecular formula C16H14O and a molecular weight of 222.29 g/mol. Its IUPAC name is (6R,9S,10R,11R,12S,15R)-4-methylhexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-3,7,13-trien-2-one.
| Compound Name | (6R,9S,10R,11R,12S,15R)-4-methylhexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-3,7,13-trien-2-one |
|---|---|
| PubChem CID | 98556963 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (6R,9S,10R,11R,12S,15R)-4-methylhexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadeca-3,7,13-trien-2-one |
| SMILES | CC1=CC(=O)C23[C@@H]4C=C[C@H]5[C@H]4[C@@H]4[C@@H](C=C[C@@H]42)C153 |
| InChI | InChI=1S/C16H14O/c1-7-6-12(17)16-10-4-2-8-13(10)14-9(15(7,8)16)3-5-11(14)16/h2-6,8-11,13-14H,1H3/t8-,9+,10+,11-,13-,14-,15?,16?/m1/s1 |
| InChIKey | BVWKKZLOECBDCT-OOGWZFQLSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|