C16H24O — CID 15966563
(1R,6S,10R)-5,5,9,10-tetramethyltricyclo[4.3.3.01,6]dodec-8-en-7-one (PubChem CID 15966563) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R,6S,10R)-5,5,9,10-tetramethyltricyclo[4.3.3.01,6]dodec-8-en-7-one.
| Compound Name | (1R,6S,10R)-5,5,9,10-tetramethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
|---|---|
| PubChem CID | 15966563 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1R,6S,10R)-5,5,9,10-tetramethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
| SMILES | CC1=CC(=O)[C@]23CC[C@@H](C)[C@]12CCCC3(C)C |
| InChI | InChI=1S/C16H24O/c1-11-6-9-16-13(17)10-12(2)15(11,16)8-5-7-14(16,3)4/h10-11H,5-9H2,1-4H3/t11-,15-,16+/m1/s1 |
| InChIKey | HBNWPKJXDGKWMU-LYRGGWFBSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |